Identification |
Name: | Sulfurous acid,dimethyl ester |
Synonyms: | Methylsulfite (6CI,7CI); Dimethoxy sulfoxide; Dimethyl sulfite; NSC 41902 |
CAS: | 616-42-2 |
EINECS: | 210-481-0 |
Molecular Formula: | C2H6 O3 S |
Molecular Weight: | 110.13 |
InChI: | InChI=1/C2H6O3S/c1-4-6(3)5-2/h1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1993 |
Density: | 1.294 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
Refractive index: | 1.4085-1.4105 |
Water Solubility: | soluble |
Solubility: | soluble in water |
Appearance: | clear, colorless liquid |
Packinggroup: | III |
HS Code: | 29209085 |
Storage Temperature: | Flammables area |
Usage: | Used as an additive in some polymers to prevent oxidation. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |