| Identification | |
| Name: | 1,3-Benzenediol, 4,6-dinitro- |
| Synonyms: | Resorcinol,4,6-dinitro- (6CI,8CI);3-Hydroxy-4,6-dinitrophenol;4,6-Dinitro-1,3-benzenediol;4,6-Dinitroresorcinol; |
| CAS: | 616-74-0 |
| EINECS: | 210-489-4 |
| Molecular Formula: | C6H4N2O6 |
| Molecular Weight: | 200.10576 |
| InChI: | InChI=1S/C6H4N2O6/c9-5-2-6(10)4(8(13)14)1-3(5)7(11)12/h1-2,9-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1322 |
| Melting Point: | 215ºC |
| Flash Point: | 186 ºC |
| Boiling Point: | 404.6ºC at 760 mmHg |
| Density: | 1.819 g/cm3 |
| Refractive index: | 1.712 |
| Water Solubility: | 78.1 mg/L in water |
| Solubility: | 78.1 mg/L in water |
| Specification: |
1,3-Benzenediol, 4,6-dinitro- (CAS NO.616-74-0) is also called as 4,6-Dinitroresorcinol ; 4,6-Dinitroresorcinol (heavy metal salts of) (dry) ; 4,6-Dinitroresorcinol (heavy metal salts of) (dry) [Forbidden] ; 1,3-Dihydroxy-4,6-dinitrobenzene ; 4,6-Dinitroresorcinol (wetted with ca. 20% water, containing 5g on a dry weight basis ; 4,6-Dinitroresorcinol (wetted with ca. 20% water, containing 5g on a dry weight basis) 95+% ; 4,6-Dinitro-1,3-benzenedi . |
| Packinggroup: | II |
| Flash Point: | 186 ºC |
| Safety Data | |
 |
|
