Identification |
Name: | tris(2-methylphenyl)phosphine |
Synonyms: | Intermediate of Eletriptan and Rizatriptan; Phosphine, tri-o-tolyl-; Tri-ortho-tolylphosphine; tris(2-methylphenyl)-phosphin; PHOSPHORUS TRI-O-TOLYL; TRIS(O-TOLYL)PHOSPHINE; TRIS(2-TOLYL)PHOSPHINE; TRI-O-TOLYPHOSPHINE |
CAS: | 6163-58-2 |
EINECS: | 228-193-9 |
Molecular Formula: | C21H21P |
Molecular Weight: | 304.365201 |
InChI: | InChI=1S/C21H21P/c1-16-10-4-7-13-19(16)22(20-14-8-5-11-17(20)2)21-15-9-6-12-18(21)3/h4-15H,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | 40kgs
|
Water Solubility: | Insoluble |
Solubility: | Insoluble
|
Appearance: | White
crystals |
Specification: | white to light yellow crystal powde usageEng:suzuki reaction Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Usage: | suzuki reaction |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |