| Identification | |
| Name: | 1H-Imidazole-4,5-dimethanol,2-phenyl- |
| Synonyms: | 2-Phenyl-1H-imidazole-4,5-dimethanol;2-Phenyl-4,5-bis(hydroxymethyl)imidazole;2-Phenyl-4,5-dihydroxymethylimidazole; 2PHZ; 2PHZ-PW;4,5-Bis(hydroxymethyl)-2-phenylimidazole;4,5-Dihydroxymethyl-2-phenylimidazole; Curezol 2PHZ |
| CAS: | 61698-32-6 |
| EINECS: | 262-911-1 |
| Molecular Formula: | C11H12 N2 O2 |
| Molecular Weight: | 204.23 |
| InChI: | InChI=1/C11H12N2O2/c14-6-9-10(7-15)13-11(12-9)8-4-2-1-3-5-8/h1-5,14-15H,6-7H2,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.327g/cm3 |
| Refractive index: | 1.652 |
| Specification: |
11H-Imidazole-4,5-dimethanol,2-phenyl- , its cas register number is 61698-32-6. It also can be called 2-Phenyl-4,5-dihydroxymethylimidazole ; 2-Phenyl-4,5-bis(hydroxymethyl)imidazole ; 4,5-Bis(hydroxymethyl)-2-phenyl-1H-imidazole ; and 4,5-Dihydroxymethyl-2-phenylimidazole . |
| Safety Data | |
 |
|
