| Identification | |
| Name: | Ethyl pyruvate |
| Synonyms: | Ethyl 2-oxopropionate; Ethyl pyruvate,(Pyruvic acid ethyl ester); Pyruvic acid ethyl ester; Brenztraubensaeure-ethylester |
| CAS: | 617-35-6 |
| EINECS: | 210-511-2 |
| Molecular Formula: | C5H8O3 |
| Molecular Weight: | 116.11522 |
| InChI: | InChI=1S/C5H8O3/c1-3-8-5(7)4(2)6/h3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 199 |
| Melting Point: | -58 C |
| Density: | 1.06 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.404-1.406 |
| Water Solubility: | 10 (g/l) |
| Solubility: | 10 (g/l) |
| Appearance: | clear to yellow liquid |
| Specification: | clear pale yellow liquid Safety Statements:16 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| HS Code: | 29183000 |
| Safety Data | |
| Hazard Symbols |
3 (Packing Group: II)
UN
NO.
|
 |
|
