| Identification | |
| Name: | Ethyl dimethyldithiocarbamate |
| Synonyms: | Dimethyldithiocarbamic acid ethyl ester;N,N-Dimethyldithiocarbamic acid ethyl ester;Preparation 23 |
| CAS: | 617-38-9 |
| Molecular Formula: | C5H11NS2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H11NS2/c1-4-8-5(7)6(2)3/h4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 67.2°C |
| Boiling Point: | 187.5°C at 760 mmHg |
| Density: | 1.087g/cm3 |
| Refractive index: | 1.557 |
| Specification: |
Ethyl dimethyldithiocarbamate , its cas register number is 617-38-9. It also can be called 4-04-00-00235 (Beilstein Handbook Reference) ; BRN 1744918 ; Ethyl dimethylcarbamodithioate ; Ethyl ester of dimethyldithiocarbamic acid ; |
| Flash Point: | 67.2°C |
| Safety Data | |
 |
|
