Identification |
Name: | DL-Aspartic acid |
Synonyms: | Asparticacid, DL- (8CI);617-45-8;(RS)-Aspartic acid;Aminosuccinicacid;DL-Aminosuccinic acid;NSC 141379;Aspartic Acid;DL-Asp-OH; |
CAS: | 617-45-8 |
EINECS: | 210-513-3 |
Molecular Formula: | C4H7NO4 |
Molecular Weight: | 133.1 |
InChI: | InChI=1/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) |
Molecular Structure: |
 |
Properties |
Transport: | 25kgs |
Density: | 1.514 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Water Solubility: | SOLUBLE |
Solubility: | soluble |
Appearance: | white powder |
Specification: | White crystalline powder Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
HS Code: | 29224995 |
Storage Temperature: | Store at RT. |
Color: | White, crystalline solid Orthorhombic bisphenoidal leaflets or rods |
Usage: | Biologically significant amino acid. |
Safety Data |
Hazard Symbols |
|
|
 |