| Identification | |
| Name: | Triethylsilane |
| Synonyms: | Triethylsilyl hydride |
| CAS: | 617-86-7 |
| EINECS: | 210-535-3 |
| Molecular Formula: | C6H16Si |
| Molecular Weight: | 116.28 |
| InChI: | InChI=1/C6H16Si/c1-4-7(5-2)6-3/h7H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 2 |
| Density: | 0.728 |
| Stability: | Stable, but moisture sensitive. Highly flammable. Generates highly flammable gas (hydrogen) in contact with water, acids and bases. |
| Refractive index: | 1.41-1.412 |
| Solubility: | decomposes
|
| Appearance: | colourless liquid |
| Specification: |
?Triethylsilane ,its CAS NO. is 617-86-7,the synonyms is EINECS 210-535-3 ; NSC 93579 ; Triethylsilicon hydride ; Silane, triethyl- . |
| Packinggroup: | II |
| HS Code: | 29310095 |
| Sensitive: | Moisture Sensitive |
| Usage: | Used in organic synthesis, specifically for the hydrosilation of olefins to give alkyl silanes. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
