| Identification | |
| Name: | N-Butyl-N-(3-oxobutyl)nitrosamine |
| Synonyms: | N-BUTYL-N-(3-OXOBUTYL)NITROSAMINE;4-(Butylnitrosoamino)-3-butanone |
| CAS: | 61734-90-5 |
| Molecular Formula: | C8H16N2O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H16N2O2/c1-3-5-6-10(9-12)7-8(11)4-2/h3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 130.8°C |
| Boiling Point: | 292.7°C at 760 mmHg |
| Density: | 1.01g/cm3 |
| Refractive index: | 1.475 |
| Specification: |
N-Butyl-N-(3-oxobutyl)nitrosamine , its cas register number is 61734-90-5. It also can be called BRN 2246430 ; N-Butyl-N-(2-oxobutyl)nitrosamine ; N-Nitroso-N-(3-oxobutyl)butylamine . When heated to decomposition it emits toxic fumes of NOx. N-Butyl-N-(3-oxobutyl)nitrosamine (CAS NO.61734-90-5) is a toxic substance. And the storage environment should be ventilate, low-temperature and dry. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 130.8°C |
| Safety Data | |
 |
|
