| Identification | |
| Name: | Methoxymethyl-ethylnitrosamine |
| Synonyms: | N-(Methoxymethyl)-N-nitrosoethanamine |
| CAS: | 61738-04-3 |
| Molecular Formula: | C4H10N2O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C4H10N2O2/c1-3-6(5-7)4-8-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 73.6°C |
| Boiling Point: | 198.1°C at 760 mmHg |
| Density: | 1.03g/cm3 |
| Refractive index: | 1.436 |
| Specification: |
Methoxymethyl-ethylnitrosamine , its cas register number is 61738-04-3. It also can be called Methoxymethyl-aethylnitrosamin ; and Ethylamine, N-(methoxymethyl)-N-nitroso- . Its classification code is Tumor data. |
| Flash Point: | 73.6°C |
| Safety Data | |
 |
|
