| Identification | |
| Name: | 1-Methoxy ethyl methylnitrosamine |
| Synonyms: | ethanamine, 1-methoxy-N-methyl-N-nitroso- |
| CAS: | 61738-05-4 |
| Molecular Formula: | C4H10N2O2 |
| Molecular Weight: | 118.1344 |
| InChI: | InChI=1/C4H10N2O2/c1-4(8-3)6(2)5-7/h4H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 68.1°C |
| Boiling Point: | 189°C at 760 mmHg |
| Density: | 1.04g/cm3 |
| Refractive index: | 1.437 |
| Specification: |
1-Methoxy ethyl methylnitrosamine with cas registry number of 61738-05-4 is also known as 1-Methoxy-aethyl-methylnitrosamin ; 1-Methoxy-aethyl-methylnitrosamin [German] ; 1-Methoxy-ethyl-methylnitrosamine ; BRN 4656067 ; Systematic Name ; Ethylamine, 1-methoxy-N-methyl-N-nitroso- . It is stable under normal temperatures and pressures but it also should be stored in a tightly closed container when not in use and stored in a cool, dry place. 1-Methoxy ethyl methylnitrosamine with cas registry number of 61738-05-4 is used as an intermediate in synthesis of many useful compounds. |
| Flash Point: | 68.1°C |
| Safety Data | |
 |
|
