| Identification | |
| Name: | 2,2-Diethoxyacetophenone |
| Synonyms: | Acetophenone,2,2-diethoxy- (7CI);Glyoxal, phenyl-, 2-(diethyl acetal) (8CI);Glyoxal,phenyl-, diethyl acetal (6CI);2,2-Diethoxy-1-phenyl-1-ethanone;2,2-Diethoxy-1-phenylethanone;Phenylglyoxal diethyl acetal;DEAP;Diethoxyacetophenone;Firstcure DEAP;Genocure DEAP;NSC 66180;Phenylglyoxaldiethyl acetal;a,a-Diethoxyacetophenone; |
| CAS: | 6175-45-7 |
| EINECS: | 228-220-4 |
| Molecular Formula: | C12H16O3 |
| Molecular Weight: | 208.26 |
| InChI: | InChI=1/C12H16O3/c1-3-14-12(15-4-2)11(13)10-8-6-5-7-9-10/h5-9,12H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.034 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4985-1.5005 |
| Solubility: | AUTOIGNITION |
| Appearance: | clear to light yellow liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
