| Identification | |
| Name: | 2-Thiazolamine,4-propyl- |
| Synonyms: | Thiazole,2-amino-4-propyl- (7CI);2-Amino-4-propylthiazole;4-Propyl-1,3-thiazol-2-ylamine;4-propyl-1,3-thiazol-2-amine;2-thiazolamine, 4-propyl-; |
| CAS: | 61764-34-9 |
| Molecular Formula: | C6H10N2S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H10N2S/c1-2-3-5-4-9-6(7)8-5/h4H,2-3H2,1H3,(H2,7,8) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.149 g/cm3 |
| Refractive index: | 1.579 |
| Specification: |
The 4-Propylthiazol-2-amine, with the CAS registry number 61764-34-9, has the systematic name of 4-propyl-1,3-thiazol-2-amine. The molecular formula of the chemical is C6H10N2S. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.90; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.06; (4)ACD/LogD (pH 7.4): 1.87; (5)ACD/BCF (pH 5.5): 2.39; (6)ACD/BCF (pH 7.4): 15.29; (7)ACD/KOC (pH 5.5): 37.46; (8)ACD/KOC (pH 7.4): 240.14; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 67.15 Å2; (13)Index of Refraction: 1.579; (14)Molar Refractivity: 41.14 cm3; (15)Molar Volume: 123.7 cm3; (16)Polarizability: 16.31×10-24cm3; (17)Surface Tension: 48.6 dyne/cm; (18)Density: 1.149 g/cm3; (19)Flash Point: 108.5 °C; (20)Enthalpy of Vaporization: 49.33 kJ/mol; (21)Boiling Point: 255.9 °C at 760 mmHg; (22)Vapour Pressure: 0.0159 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
