| Identification | |
| Name: | Phenol,2-methoxy-4-(2-nitroethenyl)- |
| Synonyms: | Guaiacol, 4-(2-nitrovinyl)- (6CI); Phenol,2-methoxy-4-(2-nitrovinyl)- (7CI,8CI); 2-Methoxy-4-(2-nitroethenyl)phenol;2-Methoxy-4-(2-nitrovinyl)phenol; 3-Methoxy-4-hydroxy-b-nitrostyrene;4-Hydroxy-3-methoxy-b-nitrostyrene; 4-Hydroxy-3-methoxy-w-nitrostyrene;NSC 37561; NSC 7376 |
| CAS: | 6178-42-3 |
| Molecular Formula: | C9H9 N O4 |
| Molecular Weight: | 195.17 |
| InChI: | InChI=1/C9H9NO4/c1-14-9-6-7(2-3-8(9)11)4-5-10(12)13/h2-6,11H,1H3/b5-4+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 168-170 °C(lit.) |
| Flash Point: | 163.7°C |
| Boiling Point: | 347°C at 760 mmHg |
| Density: | 1.308g/cm3 |
| Refractive index: | 1.615 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 163.7°C |
| Safety Data | |
 |
|
