| Identification | |
| Name: | Benzoicacid, 3,5-dibromo- |
| Synonyms: | - |
| CAS: | 618-58-6 |
| Molecular Formula: | C7H4Br2O2 |
| Molecular Weight: | 279.91 |
| InChI: | InChI=1/C7H4Br2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.6°C |
| Boiling Point: | 355.2°C at 760 mmHg |
| Density: | 2.083 g/cm3 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
Removal in wastewater treatment of 3,5-Dibromobenzoic acid (618-58-6) can be stated as follows: |
| Flash Point: | 168.6°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
