| Identification | |
| Name: | Benzene,1-methyl-3,5-dinitro- |
| Synonyms: | Toluene,3,5-dinitro- (8CI); 1-Methyl-3,5-dinitrobenzene; 3,5-DNT; 3,5-Dinitrotoluene;5-Methyl-1,3-dinitrobenzene; NSC 87348 |
| CAS: | 618-85-9 |
| EINECS: | 210-566-2 |
| Molecular Formula: | C7H6 N2 O4 |
| Molecular Weight: | 182.15 |
| InChI: | InChI=1/C7H6N2O4/c1-5-2-6(8(10)11)4-7(3-5)9(12)13/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 93 deg C |
| Flash Point: | 152.6°C |
| Boiling Point: | 307.5°C at 760 mmHg |
| Density: | 1.407g/cm3 |
| Refractive index: | 1.598 |
| Solubility: | Soluble in benzene, ethyl ether, ethanol, chloroform, carbon disulfide In water, 145 mg/L at 25 deg C (est) |
| Specification: | Safety Statements:53-45-61 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 152.6°C |
| Color: | Yellowish, reddish needles from acetic acid |
| Safety Data | |
 |
|
