Identification |
Name: | 5-Nitroisophthalic acid |
Synonyms: | 5-Nitrobenzene-1,3-dicarboxylic acid; 5-NIPA; 5-Nitro-1,3-benzenedicarboxylic acid; 5-Nitroisophthalic acid |
CAS: | 618-88-2 |
EINECS: | 210-568-3 |
Molecular Formula: | C8H5NO6 |
Molecular Weight: | 211.13 |
InChI: | InChI=1/C8H5NO6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13) |
Molecular Structure: |
 |
Properties |
Transport: | 2811 |
Flash Point: | 120ºC |
Density: | 1.671 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Solubility: | Very soluble |
Appearance: | Off White To Ivory Powder |
Flash Point: | 120ºC |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |