| Identification | |
| Name: | Benzoic acid, 3-nitro-,ethyl ester |
| Synonyms: | Benzoicacid, m-nitro-, ethyl ester (6CI,7CI,8CI);3-Nitrobenzoic acid ethyl ester;Ethyl 3-nitrobenzoate;Ethyl m-nitrobenzoate;NSC 32740;NSC 6762; |
| CAS: | 618-98-4 |
| EINECS: | 210-574-6 |
| Molecular Formula: | C9H9NO4 |
| Molecular Weight: | 195.17206 |
| InChI: | InChI=1S/C9H9NO4/c1-2-14-9(11)7-4-3-5-8(6-7)10(12)13/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 297-298°C |
| Density: | 1.253g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.544 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC, though apossible sensitizer. Toxicity data |
| Solubility: |
|
| Appearance: | solid |
| Specification: | solid Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Safety Data | |
 |
|
