Identification |
Name: | 2-Propenoic acid, butyl ester, polymer with carbon monoxide and ethene |
Synonyms: | 2-Propenoic acid, butyl ester, polymer with carbon monoxide and ethene;Butyl 2-propenoate polymer with carbon monoxide and ethene |
CAS: | 61843-70-7 |
Molecular Formula: | C10H18O3 |
Molecular Weight: | 186.24812 |
InChI: | InChI=1S/C7H12O2.C2H4.CH2O/c1-3-5-6-9-7(8)4-2;2*1-2/h4H,2-3,5-6H2,1H3;1-2H2;1H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 39.4°C |
Boiling Point: | 145.9°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 39.4°C |
Safety Data |
|
|