| Identification | |
| Name: | 6-Chloroimidazo[1,2-a]pyridine |
| Synonyms: | 3-chloro-1,7-diazabicyclo[4.3.0]nona-2,4,6,8-tetraene;imidazo[1,2-a]pyridine, 6-chloro-; |
| CAS: | 6188-25-6 |
| Molecular Formula: | C7H5ClN2 |
| Molecular Weight: | 152.581 |
| InChI: | InChI=1/C7H5ClN2/c8-6-1-2-7-9-3-4-10(7)5-6/h1-5H |
| Molecular Structure: | ![(C7H5ClN2) 3-chloro-1,7-diazabicyclo[4.3.0]nona-2,4,6,8-tetraene;imidazo[1,2-a]pyridine, 6-chloro-;](https://img1.guidechem.com/chem/e/dict/22/6188-25-6.jpg) |
| Properties | |
| Density: | 1.35 g/cm3 |
| Refractive index: | 1.653 |
| Specification: |
The 6-Chloroimidazo[1,2-a]pyridine, with the CAS registry number 6188-25-6, is also called imidazo[1,2-a]pyridine, 6-chloro-. And the molecular formula of the chemical is C7H5ClN2. The characteristics of 6-Chloroimidazo[1,2-a]pyridine are as followings: (1)ACD/LogP: 2.00; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.83; (4)ACD/LogD (pH 7.4): 1.99; (5)ACD/BCF (pH 5.5): 13.09; (6)ACD/BCF (pH 7.4): 19.25; (7)ACD/KOC (pH 5.5): 196.27; (8)ACD/KOC (pH 7.4): 288.6; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 17.3 Å2; (13)Index of Refraction: 1.653; (14)Molar Refractivity: 41.31 cm3; (15)Molar Volume: 112.8 cm3; (16)Polarizability: 16.37×10-24cm3; (17)Surface Tension: 48.5 dyne/cm; (18)Density: 1.35 g/cm3. You should be cautious while dealing with this chemical. It irritates to eyes, respiratory system and skin. Therefore, you had better take the following instructions: Wear suitable protective clothing, gloves and eye/face protection, and if in case of contacting with eyes, rinse immediately with plenty of water and seek medical advice. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
