| Identification | ||
| Name: | Benzoic acid,2-amino-4-nitro- | |
| Synonyms: | Anthranilicacid, 4-nitro- (6CI,7CI,8CI);2-Amino-4-nitrobenzoic acid;2-Carboxy-5-nitroaniline;4-Nitro-2-aminobenzoic acid;NSC 7789; | |
| CAS: | 619-17-0 | |
| EINECS: | 210-583-5 | |
| Molecular Formula: | C7H6N2O4 | |
| Molecular Weight: | 182.13 | |
| InChI: | InChI=1/C7H6N2O4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,8H2,(H,10,11) | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.568 g/cm3 | |
| Stability: | No data. | |
| Refractive index: | 1.681 | |
| Water Solubility: | <0.01 g/100 mL at 22 ºC | |
| Solubility: | <0.01 g/100 mL at 22 oC in water | |
| Appearance: | right yellow powder | |
| Specification: | Orange crystalline powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Color: | ORANGE PRISMS (DIL ALCOHOL) | |
| Usage: | Research chemical. | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
