| Identification | |
| Name: | 4-Cyanobenzoic acid |
| Synonyms: | 4-Cyanobenzoic acid,98%; 4-Cyanobenzoic Acid/4-Carboxybenzonitrile; 4-Carboxybenzonitrile |
| CAS: | 619-65-8 |
| EINECS: | 210-606-9 |
| Molecular Formula: | C8H5NO2 |
| Molecular Weight: | 147.1308 |
| InChI: | InChI=1S/C8H5NO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.32 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, strong bases. |
| Refractive index: | 1.592 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents, strong acids,strong bases. Toxicology Harmful if swallowed, inhaled or absorbed through the skin.Irritant. Toxicity |
| Solubility: |
|
| Appearance: | white crystal |
| Specification: |
?4-Cyanobenzoic acid (CAS NO.619-65-8)?is also called 4-Cyanobenzoic ; 4-Cyano-benzoicaci ; Benzoic acid, p-cyano- ; p-Carboxybenzonitrile ; Terephthalic mononitrile ; 4-Carboxybenzonitrile ; p-Cyanobenzoic acid . |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Usage: | An inhibitor. The studies show that 4-cyanobenzaldehyde and 4-cyanobenzoic acid can inhibit both the monophenolase activity and the diphenolase activity of mushroom tyrosinase. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
