| Identification | |
| Name: | 1,4-Cyclohexanedicarboxylicacid, cis- |
| Synonyms: | 1,4-cis-Cyclohexanedicarboxylicacid;cis-1,4-Cyclohexanedicarboxylic acid;cis-Hexahydroterephthalic acid; |
| CAS: | 619-81-8 |
| Molecular Formula: | C8H12O4 |
| Molecular Weight: | 172.18 |
| InChI: | InChI=1/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.314 g/cm3 |
| Refractive index: | 1.521 |
| Specification: |
The cas register number of cis-1,4-Cyclohexanedicarboxybic acid is 619-81-8. It also can be called as 1,4-Cyclohexanedicarboxylicacid, cis- and the IUPAC Name about this chemical is cyclohexane-1,4-dicarboxylic acid. It belongs to the following product categories, such as chiral, 4-Substituted Cyclohexanecarboxylic Acids and so on. Physical properties about cis-1,4-Cyclohexanedicarboxybic acid are: (1)ACD/LogP: 0.50; (2)ACD/LogD (pH 5.5): -0.83; (3)ACD/LogD (pH 7.4): -3.96; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 2.09; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 2; (11)Polar Surface Area: 52.6Å2; (12)Index of Refraction: 1.521; (13)Molar Refractivity: 39.88 cm3; (14)Molar Volume: 130.9 cm3; (15)Polarizability: 15.81x10-24cm3; (16)Surface Tension: 57.8 dyne/cm; (17)Enthalpy of Vaporization: 69.46 kJ/mol; (18)Vapour Pressure: 5.78E-07 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
