| Identification | |
| Name: | Benzoicacid, 4-ethoxy- |
| Synonyms: | Benzoicacid, p-ethoxy- (6CI,7CI,8CI); 4-Ethoxybenzoic acid; ACS 0393; NSC 8705;p-Ethoxybenzoic acid |
| CAS: | 619-86-3 |
| EINECS: | 210-616-3 |
| Molecular Formula: | C9H10 O3 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C9H10O3/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 117.1°C |
| Boiling Point: | 291.2°C at 760 mmHg |
| Density: | 1.166g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.537 |
| Solubility: | Soluble |
| Appearance: | White solid. |
| Specification: | White to light yellow crystal powder usageEng:Intermediates of Liquid Crystals Safety Statements:26-37/39-24/25-25-24 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 24/25:Avoid contact with skin and eyes 25:Avoid contact with eyes 24:Avoid contact with skin |
| Flash Point: | 117.1°C |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
 |
|
