| Identification | |
| Name: | 2-Propenoyl chloride,3-ethoxy- |
| Synonyms: | Acryloylchloride, 3-ethoxy- (6CI,7CI,8CI);3-Ethoxyacryloyl chloride;3-Ethoxyprop-2-enoyl chloride;b-Ethoxyacrylic acid chloride;b-Ethoxyacrylic chloride;b-Ethoxyacryloyl chloride;(2E)-3-ethoxyprop-2-enoyl chloride; |
| CAS: | 6191-99-7 |
| EINECS: | 228-239-8 |
| Molecular Formula: | C5H7ClO2 |
| Molecular Weight: | 134.56 |
| InChI: | InChI=1/C5H7ClO2/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2920 8/PG 2 |
| Density: | 1.125 g/cm3 |
| Refractive index: | 1.446 |
| Specification: |
The 3-Ethoxyacryloyl chloride, with the CAS registry number 6191-99-7 and EINECS registry number 228-239-8, has the systematic name of (2E)-3-ethoxyprop-2-enoyl chloride. It belongs to the following product categories: Small molecule; Acid HalidesOrganic Building Blocks; Acyclic; Alkenes; Carbonyl Compounds; Organic Building Blocks. And the molecular formula of the chemical is C5H7ClO2. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.53; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.53; (4)ACD/LogD (pH 7.4): 1.53; (5)ACD/BCF (pH 5.5): 8.56; (6)ACD/BCF (pH 7.4): 8.56; (7)ACD/KOC (pH 5.5): 161.89; (8)ACD/KOC (pH 7.4): 161.89; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 26.3 Å2; (13)Index of Refraction: 1.446; (14)Molar Refractivity: 31.89 cm3; (15)Molar Volume: 119.5 cm3; (16)Polarizability: 12.64×10-24cm3; (17)Surface Tension: 30.7 dyne/cm; (18)Density: 1.125 g/cm3; (19)Flash Point: 62.1 °C; (20)Enthalpy of Vaporization: 40.82 kJ/mol; (21)Boiling Point: 171.8 °C at 760 mmHg; (22)Vapour Pressure: 1.38 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
