| Identification | |
| Name: | Ethanol, 2-phenoxy-,1-acetate |
| Synonyms: | Ethanol,2-phenoxy-, acetate (6CI,7CI,8CI,9CI); 1-Acetoxy-2-phenoxyethane;2-Phenoxyethanol acetate; 2-Phenoxyethyl acetate; Ethylene glycol monophenylether acetate; Ethylene glycol phenyl ether acetate; NSC 6554; b-Phenoxyethyl acetate |
| CAS: | 6192-44-5 |
| Molecular Formula: | C10H12 O3 |
| Molecular Weight: | 180.203 |
| InChI: | InChI=1/C10H12O3/c1-9(11)12-7-8-13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 141°C |
| Boiling Point: | 243.6°C at 760 mmHg |
| Density: | 1,11 g/cm3 |
| Refractive index: | 1.495 |
| Solubility: | soluble in acetone and ether |
| Appearance: | Colorless liquid |
| Specification: |
Ethylene glycol phenyl ether acetate ,its cas register number is 6192-44-5. It also can be called Ethanol, 2-phenoxy-, acetate ; 2-Phenoxyethanol acetate ; 2-Phenoxyethyl acetate ; and Acetic acid 2-phenoxyethyl ester . |
| Flash Point: | 141°C |
| Safety Data | |
 |
|
