| Identification | |
| Name: | Thioacetamide |
| Synonyms: | Ethanethioamide |
| CAS: | 62-55-5 |
| EINECS: | 200-541-4 |
| Molecular Formula: | C2H5NS |
| Molecular Weight: | 75.13 |
| InChI: | InChI=1/C2H5NS/c1-2(3)4/h1H3,(H2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.37 |
| Stability: | Stability Incompatible with water, mineral acids. |
| Refractive index: | 1.543 |
| Solubility: | Stability Incompatible with water, mineral acids |
| Appearance: | white solid |
| Specification: |
Thioacetamide , with CAS number of 62-55-5, can be called ethanethioamide ; Acetamide, thio- ; Acetic acid, thiono-, amide ; Acetimidic acid, thio- ; Acetimidic acid, thio- (7CI) . Thioacetamide (CAS NO.62-55-5) is a white solid, can be used as the production of catalysts, stabilizers, inhibitor, electroplating additives, photographic drugs, pesticides, dyeing auxiliary and ore dressing agent. Also used as a polymer curing agent, crosslinking agent, rubber additives and pharmaceutical raw materials. The production methods of Thioacetamide (CAS NO.62-55-5) is acetonitrile and hydrogen sulfide reaction or to acetamide with phosphorus pentasulfide reaction. |
| HS Code: | 29309070 |
| Storage Temperature: | Store at RT. |
| Color: | Crystals from benzene Colorless leaflets Yellow tablets CRYSTALS FROM ALC, PLATES FROM ETHER |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
