| Identification | |
| Name: | 3-Methylbenzyl chloride |
| Synonyms: | m-Xylene, a-chloro- (7CI,8CI);1-Chloromethyl-3-methylbenzene;1-Methyl-3-chloromethylbenzene;3-(Chloromethyl)toluene;3-Methylphenylmethylchloride;NSC 76592;m-(Chloromethyl)toluene;m-Methylbenzyl chloride;m-Xylylchloride;m-Xylyl-a-chloride;a-Chloro-m-xylene;Benzene,1-(chloromethyl)-3-methyl-; |
| CAS: | 620-19-9 |
| EINECS: | 210-628-9 |
| Molecular Formula: | C8H9Cl |
| Molecular Weight: | 140.61 |
| InChI: | InChI=1/C8H9Cl/c1-7-3-2-4-8(5-7)6-9/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 2 |
| Density: | 1.064 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5335-1.5365 |
| Water Solubility: | Insoluble |
| Solubility: | insoluble in water |
| Appearance: | clear colorless to slightly yellow liquid |
| Specification: |
m-Xylyl chloride (CAS NO.620-19-9), its Synonyms are 3-(Chloromethyl)toluene ; 3-Methylbenzyl chloride ; alpha-Chloro-m-xylene ; m-(Chloromethyl)toluene ; m-Methylbenzyl chloride ; m-Xylyl-alpha-chloride ; Benzene, 1-(chloromethyl)-3-methyl- (9CI) ; m-Xylene, alpha-chloro- (8CI) . |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
