| Identification | |
| Name: | 3-Chlorobenzyl chloride |
| Synonyms: | 1-chloro-3-(chloromethyl)-benzene; alpha,3-Dichlorotoluene; m-chlorobenzyl chloride |
| CAS: | 620-20-2 |
| EINECS: | 210-629-4 |
| Molecular Formula: | C7H6Cl2 |
| Molecular Weight: | 161.02854 |
| InChI: | InChI=1S/C7H6Cl2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2235 |
| Melting Point: | 69-71 |
| Density: | 1.27 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.554-1.556 |
| Water Solubility: | Insoluble AUTOIGNITION |
| Solubility: | Insoluble AUTOIGNITION |
| Appearance: | clear liquid |
| Specification: | Colorless to light yellow liqui Safety Statements:26-36/37/39-45-61-14C 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
