| Identification |
| Name: | Benzenemethanol,3-hydroxy- |
| Synonyms: | Benzylalcohol, m-hydroxy- (6CI,7CI,8CI);3-(Hydroxymethyl)phenol;3-Hydroxybenzenemethanol;KSD 2405;NSC 60735;m-Hydroxybenzyl alcohol; |
| CAS: | 620-24-6 |
| EINECS: | 210-633-6 |
| Molecular Formula: | C7H8O2 |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C7H8O2/c8-5-6-2-1-3-7(9)4-6/h1-4,8-9H,5H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 147.3 ºC |
| Boiling Point: | 289.2ºC at 760 mm |
| Density: | 300 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5418 (25 C) |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | off-white to tan crystalline powder. |
| HS Code: | 29072900 |
| Flash Point: | 147.3 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
