| Identification |
| Name: | 2,5-Cyclohexadien-1-one,2,6-dichloro-4-[(4-hydroxyphenyl)imino]-, sodium salt (1:1) |
| Synonyms: | 2,5-Cyclohexadien-1-one,2,6-dichloro-4-[(4-hydroxyphenyl)imino]-, sodium salt (9CI);Indophenol, 2,6-dichloro-, sodium salt(8CI);Sodium,[p-[(3,5-dichloro-4-oxo-2,5-cyclohexadien-1-ylidene)amino]phenoxy]- (7CI);2,6-Dichloroindophenol sodium;2,6-Dichlorophenol indophenol sodium salt;Sodium2,6-dichloroindophenol;Sodium 2,6-dichloroindophenolate;Tillmans' reagent; |
| CAS: | 620-45-1 |
| EINECS: | 210-640-4 |
| Molecular Formula: | C12H6Cl2NNaO2 |
| Molecular Weight: | 290.08 |
| InChI: | InChI=1/C12H7Cl2NO2.Na/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7;/h1-6,16H;/q;+1/p-1 |
| Molecular Structure: |
![(C12H6Cl2NNaO2) 2,5-Cyclohexadien-1-one,2,6-dichloro-4-[(4-hydroxyphenyl)imino]-, sodium salt (9CI);Indophenol, 2,6-...](https://img.guidechem.com/casimg/620-45-1.gif) |
| Properties |
| Melting Point: | >300ºC |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong reducing agents. Air and moisture sensitive. Hygroscopic. |
| Solubility: | Slightly soluble |
| Appearance: | odorless dark green solid |
| HS Code: | 29252000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Sensitive: | Light Sensitive |
| Usage: | Analytical reagent in the determination of ascorbic acid (vitamin c) which reduces the dye to a colorless hydroxy compound. |
| Safety Data |
| |
 |
