| Identification | |
| Name: | LFM-A13 |
| Synonyms: | LFM-A13;2-CYANO-N-(2,5-DIBROMOPHENYL)-3-HYDROXY-2-BUTENAMIDE;ALPHA-CYANO-BETA-HYDROXY-BETA-METHYL-N-(2,5-DIBROMOPHENYL)PROPENAMIDE;2-Cyano-N-(2,5-dibromophenyl)-3-hydroxy-2-buteneamide |
| CAS: | 62004-35-7 |
| Molecular Formula: | C11H8Br2N2O2 |
| Molecular Weight: | 360 |
| InChI: | InChI=1/C11H8Br2N2O2/c1-6(16)8(5-14)11(17)15-10-4-7(12)2-3-9(10)13/h2-4,16H,1H3,(H,15,17)/b8-6- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 248.9°C |
| Boiling Point: | 487.9°C at 760 mmHg |
| Density: | 1.909g/cm3 |
| Refractive index: | 1.677 |
| Specification: | Safety Statements:36/37 36/37:Wear suitable protective clothing and gloves |
| Biological Activity: | Potent and selective inhibitor of Bruton's tyrosine kinase (BTK). Inhibits recombinant BTK with an IC 50 value of 2.5 μ M and has no activity on other protein kinases ( including JAK1, JAK3, HCK, EGFR kinase and insulin receptor kinase) at concentrations of up to 278 μ M. |
| Flash Point: | 248.9°C |
| Storage Temperature: | −20°C |
| Color: | white |
| Safety Data | |
 |
|
