| Identification | |
| Name: | Propanediamide, 2-amino- |
| Synonyms: | 2-Aminopropanediamide; |
| CAS: | 62009-47-6 |
| EINECS: | 263-370-4 |
| Molecular Formula: | C3H7N3O2 |
| Molecular Weight: | 117.10658 |
| InChI: | InChI=1/C3H7N3O2/c4-1(2(5)7)3(6)8/h1H,4H2,(H2,5,7)(H2,6,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 201.8 °C |
| Boiling Point: | 410.1 °C at 760 mmHg |
| Density: | 1.399 g/cm3 |
| Refractive index: | 1.547 |
| Specification: | Beige Solid usageEng:Reagent used in the synthesis of Imidazole derivatives. |
| Flash Point: | 201.8 °C |
| Storage Temperature: | -20?C Freezer |
| Usage: | Reagent used in the synthesis of Imidazole derivatives. |
| Safety Data | |
 |
|
