| Identification | |
| Name: | beta-Alanine, N-butyl-N-nitroso- |
| CAS: | 62018-92-2 |
| Molecular Formula: | C7H14N2O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C7H14N2O3/c1-2-3-5-9(8-12)6-4-7(10)11/h2-6H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 171.1°C |
| Boiling Point: | 359.3°Cat760mmHg |
| Density: | 1.14g/cm3 |
| Specification: |
beta-Alanine, N-butyl-N-nitroso- , its cas register number is 62018-92-2. It also can be called BRN 2250318 ; N-Butyl-N-(2-carboxyethyl)nitrosamine . When heated to decomposition it emits toxic fumes of NOx. The storage environment of |
| Flash Point: | 171.1°C |
| Safety Data | |
 |
|
