| Identification |
| Name: | 4-Dimethylaminocinnamaldehyde |
| Synonyms: | p-Dimethylaminocinnamaldehyde; 4-(Dimethylamino)cinnamaldehyde |
| CAS: | 6203-18-5 |
| EINECS: | 228-267-0 |
| Molecular Formula: | C11H13NO |
| Molecular Weight: | 175.22702 |
| InChI: | InChI=1S/C11H13NO/c1-12(2)11-7-5-10(6-8-11)4-3-9-13/h3-9H,1-2H3/b4-3+ |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1789 8 |
| Density: | 1.057 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | 1.599 |
| Water Solubility: | dioxane: 50 mg/mL, clear |
| Solubility: | dioxane: 50 mg/mL, clear |
| Appearance: | Deep Yellow Fine Crystals |
| Storage Temperature: | −20°C |
| Sensitive: | Air & Light Sensitive |
| Usage: | Reagent for assay of indole product of apotryptophanase and tryptophanase.1 DMAC produces colored adducts with flavanols for subsequent HPLC.2,3 It has been used in a chromogenic method for quantifying proanthocyandines in cranberry powder.4,5 |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
