Identification |
Name: | 1,3,5-Triazine-2,4-diamine,6-ethoxy-2-N-methyl- |
Synonyms: | 1,3,5-Triazine-2,4-diamine,6-ethoxy-N-methyl- (9CI); |
CAS: | 62096-63-3 |
EINECS: | 403-580-7 |
Molecular Formula: | C6H11N5O |
Molecular Weight: | 169.18 |
InChI: | InChI=1/C6H11N5O/c1-3-12-6-10-4(7)9-5(8-2)11-6/h3H2,1-2H3,(H3,7,8,9,10,11) |
Molecular Structure: |
![(C6H11N5O) 1,3,5-Triazine-2,4-diamine,6-ethoxy-N-methyl- (9CI);](https://img.guidechem.com/casimg/62096-63-3.gif) |
Properties |
Flash Point: | 175.1 °C |
Boiling Point: | 365.9 °C at 760 mmHg |
Density: | 1.288 g/cm3 |
Refractive index: | 1.612 |
Appearance: | yellow to beige crystalline powder |
Specification: | yellow to beige crystalline powder |
Flash Point: | 175.1 °C |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
![](/images/detail_15.png) |