| Identification | |
| Name: | L-Tyrosine, 3-nitro- |
| Synonyms: | Tyrosine,3-nitro-, L- (8CI);3-Nitro-L-tyrosine;NSC 37413;H-Tyr(3-NO2)-OH; |
| CAS: | 621-44-3 |
| EINECS: | 210-688-6 |
| Molecular Formula: | C9H10N2O5 |
| Molecular Weight: | 226.19 |
| InChI: | InChI=1/C9H10N2O5/c10-6(9(13)14)3-5-1-2-8(12)7(4-5)11(15)16/h1-2,4,6,12H,3,10H2,(H,13,14)/t6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.531 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 4 º (C=1, 1N HCL) |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Yellow to green powder. |
| Storage Temperature: | -15°C |
| Color: | yellow to green |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
