| Identification | |
| Synonyms: | benzenamine, 4,4'-(1,2-ethenediyl)bis- |
| CAS: | 621-96-5 |
| Molecular Formula: | C14H14N2 |
| Molecular Weight: | 210.2744 |
| InChI: | InChI=1/C14H14N2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h1-10H,15-16H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 262.5°C |
| Boiling Point: | 438.5°C at 760 mmHg |
| Density: | 1.186g/cm3 |
| Refractive index: | 1.748 |
| Specification: |
4,4′-Stilbenediamine , its CAS number is 621-96-5, it can be called 4,4'-(1,2-Ethenediyl)bisbenzenamine ; 4,4'-Vinylenedianiline ; 4:4'-Diaminostilbene and so on. |
| Report: |
4,4′-Stilbenediamine (CAS NO. 621-96-5) can be reported in BMBUAQ British Medical Bulletin. |
| Flash Point: | 262.5°C |
| Safety Data | |
 |
|
