| Identification | |
| Name: | 2-chloro-1,4-benzenediamine sulfate |
| Synonyms: | 2-Chloro-p-phenylenediamine sulfate |
| CAS: | 6219-71-2 |
| EINECS: | 228-291-1 |
| Molecular Formula: | C6H7ClN2?H2SO4 |
| Molecular Weight: | 240.66 |
| InChI: | InChI=1/C6H7ClN2.H2O4S/c7-5-3-4(8)1-2-6(5)9;1-5(2,3)4/h1-3H,8-9H2;(H2,1,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 263 ºC |
| Boiling Point: | 511.3 ºC at 760 mmHg |
| Density: | 1.42 g/cm3 |
| Specification: |
2-Chlorobenzene-1,4-diamine; sulfuric acid with CAS number of 6219-71-2 is also named as 1-Chloro-2,5-diaminobenzene sulfate ; 2,5-Diaminochlorobenzene sulfate ; 2-Chloro-1,4-benzenediamine sulfate ; 2-Chloro-1,4-diaminobenzene sulphate ; 2-Chloro-1,4-diaminobenzene sulfate ; 2-Chloro-1,4-phenylenediammonium sulfate ; 2-Chloro-1,4-phenylenediamine sulphate ; 2-Chloro-p-phenylenediamine sulphate . This product can be used as a dye intermediate. |
| Report: |
NCI Carcinogenesis Bioassay (Feed); Results Negative: mouse, rat NCITR* National Cancer Institute Carcinogenesis Technical Report Series. (Bethesda, MD 20014) No. NCI-CG-TR-113 ,1978. |
| Flash Point: | 263 ºC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
