Identification |
Name: | Butanedioic acid,2,3-dihydroxy- (2R,3R)-, 1,4-bis(phenylmethyl) ester |
Synonyms: | Butanedioicacid, 2,3-dihydroxy- (2R,3R)-, bis(phenylmethyl) ester (9CI); Butanedioic acid,2,3-dihydroxy- [R-(R*,R*)]-, bis(phenylmethyl) ester; Tartaric acid, dibenzylester, (+)- (8CI); Dibenzyl (2R,3R)-tartrate; Dibenzyl (R,R)-tartrate; DibenzylL-tartrate; Dibenzyl tartrate |
CAS: | 622-00-4 |
Molecular Formula: | C18H18 O6 |
Molecular Weight: | 330.33 |
InChI: | InChI=1/C18H18O6/c19-15(17(21)23-11-13-7-3-1-4-8-13)16(20)18(22)24-12-14-9-5-2-6-10-14/h1-10,15-16,19-20H,11-12H2/t15-,16-/m1/s1 |
Molecular Structure: |
 |
Properties |
Melting Point: | 51-54 °C
|
Flash Point: | 171.5°C |
Boiling Point: | 480.9°C at 760 mmHg |
Density: | 1.312g/cm3 |
Refractive index: | -13 ° (C=1, Acetone) |
Specification: | Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
Flash Point: | 171.5°C |
Safety Data |
|
 |