| Identification | |
| Name: | Carbonimidicdichloride, N-phenyl- |
| Synonyms: | Carbonimidicdichloride, phenyl- (9CI); Imidocarbonyl chloride, phenyl- (6CI,7CI,8CI);(Phenylimino)carbonyl dichloride; 1,1-Dichloro-N-phenylmethanimine;Benzenamine, N-(dichloromethylene)-; Carbonic dichloride, (phenylimino)-;Dichloro(phenylimino)methane; N-(Dichloromethylene)aniline;N-(Phenylimino)phosgene; N-Phenylcarbimide dichloride; N-Phenylimidophosgene;N-Phenylimidoyl dichloride; N-Phenyliminocarbonyl dichloride; NSC 2051; Phenylcarbylamine chloride; Phenyl isocyanide, dichloride; Phenylcarbonimidicdichloride; Phenylimidocarbonyl chloride; Phenylisonitrile dichloride |
| CAS: | 622-44-6 |
| EINECS: | 210-735-0 |
| Molecular Formula: | C7H5 Cl2 N |
| Molecular Weight: | 174.03 |
| InChI: | InChI=1/C7H5Cl2N/c8-7(9)10-6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1672 |
| Melting Point: | 19.5 |
| Flash Point: | 175 F |
| Boiling Point: | 103 - 106 C at 30 mm Hg |
| Density: | 1,26 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.571(lit.) |
| Solubility: |
|
| Appearance: | colourless to light yellow liquid |
| Specification: | colourless to light yellow liquid Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | 175 F |
| Color: | PALE-YELLOW, OILY LIQUID |
| Safety Data | |
 |
|
