| Identification | |
| Name: | Acetic acid, cyclohexylester |
| Synonyms: | Cyclohexanol,acetate (6CI); Acetic acid cyclohexanyl ester; Acetoxycyclohexane; Cyclohexylacetate; NSC 8772 |
| CAS: | 622-45-7 |
| EINECS: | 210-736-6 |
| Molecular Formula: | C8H14 O2 |
| Molecular Weight: | 142.19556 |
| InChI: | InChI=1S/C8H14O2/c1-7(9)10-8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2243 |
| Flash Point: | 58 ºC |
| Density: | 0.966 |
| Refractive index: | 1.439 |
| Water Solubility: | Insoluble in water; miscible in ether |
| Solubility: | Insoluble in water; miscible in ether |
| Appearance: | COLOURLESS LIQUID |
| Specification: |
Cyclohexyl acetate (622-45-7) should be tightly closed in a well-ventilated place. Protective closing should be selected specifically for the working place, depending on concentration and quantity of the hazardous substances handled. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 58 ºC |
| Color: | COLORLESS OILY LIQUID |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
