| Identification | |
| Name: | p-tolyl isothiocyanate |
| Synonyms: | Isothiocyanicacid, p-tolyl ester (6CI,7CI,8CI); 1-Isothiocyanato-4-methylbenzene;4-Methylphenyl isothiocyanate; 4-Tolyl isothiocyanate; p-Methylphenylisothiocyanate; p-Tolyl isothiocyanate |
| CAS: | 622-59-3 |
| EINECS: | 210-745-5 |
| Molecular Formula: | C8H7NS |
| Molecular Weight: | 149.21 |
| InChI: | InChI=1/C8H7NS/c1-7-2-4-8(5-3-7)9-6-10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.02 g/cm3 |
| Refractive index: | 1.6335-1.6355 |
| Water Solubility: | may decompose |
| Solubility: | MAY DECOMPOSE with water |
| Appearance: | White to yellow Solid |
| Packinggroup: | III |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
T:Toxic
Xn:Harmful
|
 |
|
