| Identification | |
| Name: | p-Phenylenediacetonitrile |
| Synonyms: | 1,4-Bis(cyanomethyl)benzene~p-Phenylenediacetonitrile; p-Xylylene dicyanide |
| CAS: | 622-75-3 |
| EINECS: | 210-751-8 |
| Molecular Formula: | C10H8N2 |
| Molecular Weight: | 156.19 |
| InChI: | InChI=1/C10H8N2/c11-7-5-9-1-2-10(4-3-9)6-8-12/h1-4H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Flash Point: | 163.6ºC |
| Boiling Point: | 334ºC at 760 mmHg |
| Density: | 1.101 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.549 |
| Solubility: | Soluble |
| Appearance: | White powder. |
| Specification: |
1,4-Benzenediacetonitrile , its cas register number is 622-75-3. It also can be called 1,4-Bis(cyanomethyl)benzene ; AI3-28790 ; NSC 513731 ; p-(Cyanomethyl)benzyl cyanide ; p-Benzenediacetonitrile ; p-Bis(cyanomethyl)benzene ; p-Phenylenediacetonitrile ; p-Xylylene dicyanide . 1,4-Benzenediacetonitrile (CAS NO.622-75-3) is a light yellow to brown crystalline powder which is harmful by inhalation, in contact with skin and if swallowed and is irritating to eyes, respiratory system and skin. |
| Packinggroup: | III |
| Flash Point: | 163.6ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
