2-Furancarboxylic acid,1-(2,2-dichloroacetyl)-1,2,3,4-tetrahydro-6-quinolinyl ester (62265-68-3)

The Quinfamide with the CAS number 62265-68-3 is also called Amenide. The IUPAC name is [1-(2,2-dichloroacetyl)-3,4-dihydro-2H-quinolin-6-yl]furan-2-carboxylate. Its molecular formula is C₁₆H₁₃Cl₂NO₄. The EINECS registry number is 263-478-1.

The properties of the chemical are: (1)ACD/LogP: 3.81; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.81; (4)ACD/LogD (pH 7.4): 3.81; (5)ACD/BCF (pH 5.5): 466.52; (6)ACD/BCF (pH 7.4): 466.52; (7)ACD/KOC (pH 5.5): 2831.25; (8)ACD/KOC (pH 7.4): 2831.26; (9)#H bond acceptors: 5; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 59.75 Å²; (13)Index of Refraction: 1.599; (14)Molar Refractivity: 84.8 cm³; (15)Molar Volume: 247.9 cm³; (16)Polarizability: 33.61×10^-24cm³; (17)Surface Tension: 54.2 dyne/cm; (18)Enthalpy of Vaporization: 83.15 kJ/mol; (19)Vapour Pressure: 3.37×10^-12 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(Oc2cc1c(N(C(=O)C(Cl)Cl)CCC1)cc2)c3occc3
(2)InChI: InChI=1/C16H13Cl2NO4/c17-14(18)15(20)19-7-1-3-10-9-11(5-6-12(10)19)23-16(21)13-4-2-8-22-13/h2,4-6,8-9,14H,1,3,7H2
(3)InChIKey: SBJGFIXQRZOVTO-UHFFFAOYAD

The toxicity data is as follows: