| Identification | |
| Name: | Benzenemethanol,2,6-dimethyl- |
| Synonyms: | Benzylalcohol, 2,6-dimethyl- (7CI);(2,6-Dimethylphenyl)methanol;2,6-Dimethylbenzylalcohol;NSC 618295; |
| CAS: | 62285-58-9 |
| Molecular Formula: | C9H12O |
| Molecular Weight: | 136.191 |
| InChI: | InChI=1/C9H12O/c1-7-4-3-5-8(2)9(7)6-10/h3-5,10H,6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.002 g/cm3 |
| Refractive index: | 1.536 |
| Specification: |
The 2,6-Dimethylbenzyl alcohol with the CAS number 62285-58-9 is also called Benzenemethanol,2,6-dimethyl-. Both the systematic name and IUPAC name are (2,6-dimethylphenyl)methanol. Its molecular formula is C9H12O. The product category is Benzhydrols, Benzyl & Special Alcohols. The properties of the chemical are: (1)ACD/LogP: 1.96; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.95; (4)ACD/LogD (pH 7.4): 1.95; (5)ACD/BCF (pH 5.5): 18.01; (6)ACD/BCF (pH 7.4): 18.01; (7)ACD/KOC (pH 5.5): 275.66; (8)ACD/KOC (pH 7.4): 275.66; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 9.23 Å2; (13)Index of Refraction: 1.536; (14)Molar Refractivity: 42.35 cm3; (15)Molar Volume: 135.8 cm3; (16)Polarizability: 16.79×10-24cm3; (17)Surface Tension: 37.5 dyne/cm; (18)Enthalpy of Vaporization: 48.87 kJ/mol; (19)Vapour Pressure: 0.0479 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
