| Identification | |
| Name: | 2-Butenoic acid, methylester, (2E)- |
| Synonyms: | 2-Butenoicacid, methyl ester, (E)-;Crotonic acid, methyl ester, (E)- (8CI);(2E)-2-Butenoic acid methyl ester;(E)-2-Butenoic acid methyl ester;(E)-Crotonic acid methyl ester;Methyl (E)-2-butenoate;Methyl E-crotonate;Methyl E-propene-1-carboxylate;Methyl trans-2-butenoate;Methyltrans-crotonate;trans-2-Butenoic acid methyl ester; |
| CAS: | 623-43-8 |
| EINECS: | 210-793-7 |
| Molecular Formula: | C5H8O2 |
| Molecular Weight: | 100.11582 |
| InChI: | InChI=1S/C5H8O2/c1-3-4-5(6)7-2/h3-4H,1-2H3/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Flash Point: | 4 oC |
| Boiling Point: | 118-120 oC |
| Density: | 0.944 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.423-1.425 |
| Water Solubility: | Immiscible with water |
| Solubility: | Immiscible with water |
| Appearance: | Colorless Liquid |
| Specification: | CLEAR COLOURLESS LIQUID Safety Statements:16-26-36-9-33 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 9:Keep container in a well-ventilated place 33:Take precautionary measures against static discharges |
| Packinggroup: | II |
| HS Code: | 29161980 |
| Flash Point: | 4 oC |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xi: Irritant
|
 |
|
