Identification |
Name: | Ethane,1,2-dichloro-1-ethoxy- |
Synonyms: | Ether,1,2-dichloroethyl ethyl (6CI,7CI,8CI); 1,2-Dichloro-1-ethoxyethane;1,2-Dichloro-2-ethoxyethane; 1,2-Dichloroethyl ethyl ether; NSC 163477; a,b-Dichloroethyl ethyl ether |
CAS: | 623-46-1 |
EINECS: | 210-794-2 |
Molecular Formula: | C4H8 Cl2 O |
Molecular Weight: | 143.01 |
InChI: | InChI=1/C4H8Cl2O/c1-2-7-4(6)3-5/h4H,2-3H2,1H3 |
Molecular Structure: |
![(C4H8Cl2O) Ether,1,2-dichloroethyl ethyl (6CI,7CI,8CI); 1,2-Dichloro-1-ethoxyethane;1,2-Dichloro-2-ethoxyethane...](https://img1.guidechem.com/chem/e/dict/114/623-46-1.jpg) |
Properties |
Transport: | UN 1993 |
Melting Point: | -72 |
Density: | 1.167 |
Stability: | Stable at normal temperatures and pressures. |
Refractive index: | 1.442 |
Solubility: | 13 g/L (25 C) |
Appearance: | Clear, very deep brown-yellow liquid. |
Packinggroup: | I |
Storage Temperature: | Keep tightly closed. Keep away from heat, sparks, and open flame. |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
![](/images/detail_15.png) |