| Identification | |
| Name: | 2-Butenoic acid,1,1'-anhydride |
| Synonyms: | 2-Butenoicacid, anhydride (9CI);Crotonic anhydride (6CI,7CI,8CI);2-Butenoic anhydride;Crotonic acid anhydride;NSC 97397;Crotonic Anhydride; |
| CAS: | 623-68-7 |
| EINECS: | 210-807-1 |
| Molecular Formula: | C8H10O3 |
| Molecular Weight: | 154.16 |
| InChI: | InChI=1/C8H10O3/c1-3-5-7(9)11-8(10)6-4-2/h3-6H,1-2H3/b5-3+,6-4+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 3 |
| Melting Point: | 72 DEG C |
| Flash Point: | 231 oF |
| Boiling Point: | 248oC |
| Density: | 1.04 g/mL at 25 oC(lit.) |
| Refractive index: | n20/D 1.473(lit.) |
| Solubility: | SOL IN ETHER |
| Specification: |
To protect yourself, you can put on faceshields, full-face respirator (US), gloves, goggles, multi-purpose combination respirator cartridge (US), type ABEK (EN14387) respirator filter. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 231 oF |
| Color: | COLORLESS LIQUID |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
