| Identification | |
| Name: | Carbamic acid,N-ethyl-, ethyl ester |
| Synonyms: | Carbamicacid, ethyl-, ethyl ester (6CI,7CI,8CI,9CI); Ethyl ethylcarbamate;N-Ethylcarbamic acid ethyl ester; N-Ethylurethane; NSC 440 |
| CAS: | 623-78-9 |
| EINECS: | 210-812-9 |
| Molecular Formula: | C5H11 N O2 |
| Molecular Weight: | 117.14634 |
| InChI: | InChI=1S/C5H11NO2/c1-3-6-5(7)8-4-2/h3-4H2,1-2H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Refractive index: | n20/D 1.421(lit.) |
| Water Solubility: | Insoluble. |
| Solubility: | Insoluble. |
| Appearance: | white |
| Specification: | Clear slightly yellow liquid Safety Statements:36/37/39-26 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
